Systematic / IUPAC Name: 1-(1,3-Benzothiazol-2-yl)-1,3-dimethylurea
ID: Reference13480
Other Names: AA-1966
Formula: C10H11N3OS
Class: Pesticides/Herbicides
Methabenzthiazuron mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 384 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/16/2025 1:32:37 PM |
| InChI | InChI=1S/C10H11N3OS/c1-11-9(14)13(2)10-12-7-5-3-4-6-8(7)15-10/h3-6H,1-2H3,(H,11,14) |
| InChI Key | RRVIAQKBTUQODI-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | AA-1966 |
| PubChem | 29216 |