Systematic / IUPAC Name: Ethyl 3-[[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxycarbonyl-methylamino]sulfanyl-propan-2-ylamino]propanoate
ID: Reference13481
Other Names: AA-2077
Formula: C20H30N2O5S
Class: Pesticides/Herbicides
Benfuracarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 4295 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/11/2025 10:48:04 AM |
| InChI | InChI=1S/C20H30N2O5S/c1-7-25-17(23)11-12-22(14(2)3)28-21(6)19(24)26-16-10-8-9-15-13-20(4,5)27-18(15)16/h8-10,14H,7,11-13H2,1-6H3 |
| InChI Key | FYZBOYWSHKHDMT-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CCN(C(C)C)SN(C)C(=O)OC1=CC=CC2=C1OC(C2)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2077 |