Systematic / IUPAC Name: 3-Formylaminophenol
ID: Reference13485
Other Names: AA-2109
Formula: C7H7NO2
Class: Pesticides/Herbicides
N-(3-Hydroxyphenyl)formamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1235 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/11/2025 10:59:54 AM |
| InChI | InChI=1S/C7H7NO2/c9-5-8-6-2-1-3-7(10)4-6/h1-5,10H,(H,8,9) |
| InChI Key | HTMAQVFRFZZDGO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)O)NC=O |
| CAS | |
| Splash | |
| Other Names | AA-2109 |