Systematic / IUPAC Name: 2,6-Dinitro-4-propan-2-yl-N,N-dipropylaniline
ID: Reference13486
Other Names:
Formula: C15H23N3O4
Class: Pesticides/Herbicides
Isopropalin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 5160 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/11/2025 11:54:11 AM |
| InChI | InChI=1S/C15H23N3O4/c1-5-7-16(8-6-2)15-13(17(19)20)9-12(11(3)4)10-14(15)18(21)22/h9-11H,5-8H2,1-4H3 |
| InChI Key | NEKOXWSIMFDGMA-UHFFFAOYSA-N |
| Canonical SMILES | CCCN(CCC)C1=C(C=C(C=C1[N+](=O)[O-])C(C)C)[N+](=O)[O-] |
| CAS | |
| Splash | |
| Other Names |