Systematic / IUPAC Name: 2,6-Dimethylmorpholine
ID: Reference13489
Other Names: AA-2110
Formula: C6H13NO
Class: Pesticides/Herbicides
2,6-Dimethylmorpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 605 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/18/2025 1:47:06 PM |
| InChI | InChI=1S/C6H13NO/c1-5-3-7-4-6(2)8-5/h5-7H,3-4H2,1-2H3 |
| InChI Key | HNVIQLPOGUDBSU-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | AA-2110 |
| PubChem | 110862 |