Systematic / IUPAC Name: 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid
ID: Reference1349
Other Names:
N-(α,α,α-Trifluoro-m-tolyl)anthranilic acid;
Achless;
Ansatin;
Anthranilic acid, N-(α,α,α-trifluoro-m-tolyl)-;
Arlef
; more
Formula: C14H10F3NO2
Class: Therapeutics/Prescription Drugs
Flufenamic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 384 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 11:31:13 AM |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) |
| InChI Key | LPEPZBJOKDYZAD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)O)NC2=CC=CC(=C2)C(F)(F)F |
| CAS | 530789 |
| Splash | |
| Other Names |
N-(α,α,α-Trifluoro-m-tolyl)anthranilic acid; Achless; Ansatin; Anthranilic acid, N-(α,α,α-trifluoro-m-tolyl)-; Arlef; Flufacid; Fluore-200; Fluphenamic acid; Fullsafe; Lanceat; Meralen; Nichisedan; Paraflu; Parlef; Parlif; Plostene; Reumajust A; Ristogen; Sastridex; Surika; Tecramine; N-[m-(Trifluoromethyl)phenyl]-2-aminobenzoic acid; N-[3-(Trifluoromethyl)phenyl]anthranilic acid; 2-[3-(Trifluoromethyl)anilino]benzoic acid; Benzoic acid, 2-{[3-(trifluoromethyl)phenyl]amino}- |
| KEGG | C13038; D01581; D03254 |
| PubChem | 3371 |
| ChEMBL | CHEMBL23588 |
| Wikipedia | Flufenamic_acid |
| ChemIDPlus | 000530789; 016449540; 001977000 |
| ChemSpider | 3254 |
| ChEBI | CHEBI:42638 |