Systematic / IUPAC Name: 2-(2-Dimethoxyphosphorylsulfanylethylsulfonyl)-N-methylpropanamide
ID: Reference13493
Other Names: AA-2152
Formula: C8H18NO6PS2
Class: Pesticides/Herbicides
Vamidothion sulfone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2039 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/18/2025 1:58:55 PM |
| InChI | InChI=1S/C8H18NO6PS2/c1-7(8(10)9-2)18(12,13)6-5-17-16(11,14-3)15-4/h7H,5-6H2,1-4H3,(H,9,10) |
| InChI Key | KOLMGNAVOCHIPY-UHFFFAOYSA-N |
| Canonical SMILES | CNC(=O)C(C)S(=O)(=O)CCSP(=O)(OC)OC |
| CAS | |
| Splash | |
| Other Names | AA-2152 |