Systematic / IUPAC Name: 2-Chloro-N-(2,6-dimethylphenyl)-N-(2-oxooxolan-3-yl)acetamide
ID: Reference13496
Other Names: AA-1979
Formula: C14H16ClNO3
Class: Pesticides/Herbicides
Ofurace mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1664 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2025 8:21:13 AM |
| InChI | InChI=1S/C14H16ClNO3/c1-9-4-3-5-10(2)13(9)16(12(17)8-15)11-6-7-19-14(11)18/h3-5,11H,6-8H2,1-2H3 |
| InChI Key | OWDLFBLNMPCXSD-UHFFFAOYSA-N |
| Canonical SMILES | Cc1cccc(C)c1N(C(=O)CCl)C1CCOC1=O |
| CAS | |
| Splash | |
| Other Names | AA-1979 |
| ChEBI | CHEBI:82792 |
| KEGG | C18800 |
| ChemSpider | 39084 |
| PubChem | 42850; 42850 |