Systematic / IUPAC Name: Ethyl 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]propanoate
ID: Reference13498
Other Names: AA-1985
Formula: C19H17ClN2O4
Class: Pesticides/Herbicides
Quizalofop-ethyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2833 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2025 8:40:11 AM |
| InChI | InChI=1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3 |
| InChI Key | OSUHJPCHFDQAIT-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-1985 |
| PubChem | 53518; 53518 |
| ChEBI | CHEBI:137937 |
| ChEMBL | CHEMBL444825 |
| ChemSpider | 48336 |
| KEGG | C18530 |