Systematic / IUPAC Name: 2-(1,2,4-Triazol-1-yl)acetic acid
ID: Reference13500
Other Names: AA-2160
Formula: C4H5N3O2
Class: Pesticides/Herbicides
1,2,4-Triazole-1-acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 400 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/25/2025 2:58:12 PM |
| InChI | InChI=1S/C4H5N3O2/c8-4(9)1-7-3-5-2-6-7/h2-3H,1H2,(H,8,9) |
| InChI Key | RXDBSQXFIWBJSR-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)Cn1cncn1 |
| CAS | |
| Splash | |
| Other Names | AA-2160 |