Systematic / IUPAC Name: (2-Butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate
ID: Reference13501
Other Names: AA-1990
Formula: C15H18N2O6
Class: Pesticides/Herbicides
Binapacryl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 383 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2025 8:49:27 AM |
| InChI | InChI=1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
| InChI Key | ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
| Canonical SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)C=C(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1990 |
| Wikipedia | Binapacryl |
| ChEBI | CHEBI:83366 |
| PubChem | 10234; 10234 |
| KEGG | C19022 |
| ChemSpider | 9817 |
| ChEMBL | CHEMBL3182974 |