Systematic / IUPAC Name: (2-Chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-λ5-phosphane
ID: Reference13502
Other Names: AA-1991
Formula: C8H9ClNO5PS
Class: Pesticides/Herbicides
Dicapthon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2968 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2025 8:55:00 AM |
| InChI | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-8-4-3-6(10(11)12)5-7(8)9/h3-5H,1-2H3 |
| InChI Key | OTKXWJHPGBRXCR-UHFFFAOYSA-N |
| Canonical SMILES | COP(=S)(OC)Oc1ccc([N+](=O)[O-])cc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-1991 |
| PubChem | 17168 |
| ChEMBL | CHEMBL160555 |
| ChemSpider | 16252 |