Systematic / IUPAC Name: 2-Dimethoxyphosphinothioylsulfanyl-N-formyl-N-methylacetamide
ID: Reference13503
Other Names: AA-1994
Formula: C6H12NO4PS2
Class: Pesticides/Herbicides
Formothion mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2732 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2025 9:00:41 AM |
| InChI | InChI=1S/C6H12NO4PS2/c1-7(5-8)6(9)4-14-12(13,10-2)11-3/h5H,4H2,1-3H3 |
| InChI Key | AIKKULXCBHRFOS-UHFFFAOYSA-N |
| Canonical SMILES | COP(=S)(OC)SCC(=O)N(C)C=O |
| CAS | |
| Splash | |
| Other Names | AA-1994 |
| ChEMBL | CHEMBL449733 |
| ChemSpider | 16412 |
| KEGG | C18988 |
| ChEBI | CHEBI:82126 |
| Wikipedia | Formothion |
| PubChem | 17345 |