Systematic / IUPAC Name: Methyl (1Z)-2-(dimethylamino)-N-(methylcarbamoyloxy)-2-oxoethanimidothioate
ID: Reference13504
Other Names: AA-1981
Formula: C7H13N3O3S
Class: Pesticides/Herbicides
Oxamyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 585 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2025 12:06:03 PM |
| InChI | InChI=1S/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12)/b9-5- |
| InChI Key | KZAUOCCYDRDERY-UITAMQMPSA-N |
| Canonical SMILES | CNC(=O)O/N=C(\SC)C(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | AA-1981 |
| PubChem | 9595287 |
| ChEBI | CHEBI:38539 |
| ChEMBL | CHEMBL2140710 |
| Wikipedia | Oxamyl |
| KEGG | C18419 |
| ChemSpider | 7869433 |