Systematic / IUPAC Name: Ethyl 2-[(4-chloro-6-methoxypyrimidin-2-yl)carbamoylsulfamoyl]benzoate
ID: Reference13507
Other Names: AA-2163
Formula: C15H15ClN4O6S
Class: Pesticides/Herbicides
Chlorimuron-ethyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3695 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2025 12:49:55 PM |
| InChI | InChI=1S/C15H15ClN4O6S/c1-3-26-13(21)9-6-4-5-7-10(9)27(23,24)20-15(22)19-14-17-11(16)8-12(18-14)25-2/h4-8H,3H2,1-2H3,(H2,17,18,19,20,22) |
| InChI Key | NSWAMPCUPHPTTC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(Cl)cc(OC)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2163 |
| PubChem | 56160 |
| ChemSpider | 50690 |
| KEGG | C10943 |
| ChEMBL | CHEMBL1231791 |
| ChEBI | CHEBI:47319 |