Systematic / IUPAC Name: [Cyano-(3-phenoxyphenyl)methyl] 2,2,3,3-tetramethylcyclopropane-1-carboxylate
ID: Reference13509
Other Names: AA-2166
Formula: C22H23NO3
Class: Pesticides/Herbicides
Fenpropathrin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 979 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2025 12:55:15 PM |
| InChI | InChI=1S/C22H23NO3/c1-21(2)19(22(21,3)4)20(24)26-18(14-23)15-9-8-12-17(13-15)25-16-10-6-5-7-11-16/h5-13,18-19H,1-4H3 |
| InChI Key | XQUXKZZNEFRCAW-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C)C(C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C1(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2166 |
| PubChem | 47326 |
| ChemSpider | 43074 |
| ChEMBL | CHEMBL522994 |
| ChEBI | CHEBI:39353 |
| Wikipedia | Fenpropathrin |
| KEGG | C18411 |