Systematic / IUPAC Name: 2,6-Dichlorobenzenecarbothioamide
ID: Reference13510
Other Names: AA-2297
Formula: C7H5Cl2NS
Class: Pesticides/Herbicides
Chlorthiamid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 255 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/1/2025 6:47:55 PM |
| InChI | InChI=1S/C7H5Cl2NS/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChI Key | KGKGSIUWJCAFPX-UHFFFAOYSA-N |
| Canonical SMILES | NC(=S)c1c(Cl)cccc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2297 |
| KEGG | C11041 |
| ChEMBL | CHEMBL3188781 |
| ChEBI | CHEBI:949 |
| ChemSpider | 2016563 |
| Wikipedia | Chlorthiamide |
| PubChem | 2734819 |