Systematic / IUPAC Name: 1-(2,4-Dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol
ID: Reference13511
Other Names: AA-2298
Formula: C15H19Cl2N3O
Class: Pesticides/Herbicides
Diclobutrazol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 288 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/1/2025 6:48:56 PM |
| InChI | InChI=1S/C15H19Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-5,7-9,13-14,21H,6H2,1-3H3 |
| InChI Key | URDNHJIVMYZFRT-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)(C)C(O)C(Cc1ccc(Cl)cc1Cl)n1cncn1 |
| CAS | |
| Splash | |
| Other Names | AA-2298 |
| ChEBI | CHEBI:4506 |
| ChEMBL | CHEMBL1553129 |
| PubChem | 53309 |
| ChemSpider | 48148 |
| KEGG | C11235 |