Systematic / IUPAC Name: Isoindole-1,3-dione
ID: Reference13512
Other Names: AA-2303
Formula: C8H5NO2
Class: Pesticides/Herbicides
Phthalimide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 180 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/1/2025 6:51:38 PM |
| InChI | InChI=1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)8(11)9-7/h1-4H,(H,9,10,11) |
| InChI Key | XKJCHHZQLQNZHY-UHFFFAOYSA-N |
| Canonical SMILES | O=C1NC(=O)c2ccccc21 |
| CAS | |
| Splash | |
| Other Names | AA-2303 |
| Wikipedia | Phthalimide |
| ChEBI | CHEBI:38817 |
| ChemSpider | 6550 |
| PubChem | 6809 |
| ChEMBL | CHEMBL277294 |