Systematic / IUPAC Name: tert-Butylsulfonylmethylsulfanyl-diethoxy-sulfanylidene-λ5-phosphane
ID: Reference13514
Other Names: AA-2169
Formula: C9H21O4PS3
Class: Pesticides/Herbicides
Terbufos-sulfone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 6968 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 7:56:21 AM |
| InChI | InChI=1S/C9H21O4PS3/c1-6-12-14(15,13-7-2)16-8-17(10,11)9(3,4)5/h6-8H2,1-5H3 |
| InChI Key | DWZSTEUTHNUVQD-UHFFFAOYSA-N |
| Canonical SMILES | CCOP(=S)(OCC)SCS(=O)(=O)C(C)(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2169 |
| ChEMBL | CHEMBL3560248 |
| ChemSpider | 38067 |
| PubChem | 41718 |