Systematic / IUPAC Name: But-3-yn-2-yl N-(3-chlorophenyl)carbamate
ID: Reference13515
Other Names: AA-2171
Formula: C11H10ClNO2
Class: Pesticides/Herbicides
Chlorbufam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3764 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 8:03:36 AM |
| InChI | InChI=1S/C11H10ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h1,4-8H,2H3,(H,13,14) |
| InChI Key | ULBXWWGWDPVHAO-UHFFFAOYSA-N |
| Canonical SMILES | C#CC(C)OC(=O)Nc1cccc(Cl)c1 |
| CAS | |
| Splash | |
| Other Names | AA-2171 |
| ChEMBL | CHEMBL1613685 |
| ChEBI | CHEBI:82186 |
| ChemSpider | 15261 |
| PubChem | 16073; 16073 |
| KEGG | C19060 |