Systematic / IUPAC Name: 5,6-Dimethyl-2,3-dihydro-1,4-dithiine 1,1,4,4-tetraoxide
ID: Reference13516
Other Names: AA-2172
Formula: C6H10O4S2
Class: Pesticides/Herbicides
Dimethipin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 722 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 8:57:34 AM |
| InChI | InChI=1S/C6H10O4S2/c1-5-6(2)12(9,10)4-3-11(5,7)8/h3-4H2,1-2H3 |
| InChI Key | PHVNLLCAQHGNKU-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C)S(=O)(=O)CCS1(=O)=O |
| CAS | |
| Splash | |
| Other Names | AA-2172 |
| ChEBI | CHEBI:81912 |
| KEGG | C18719 |
| PubChem | 41385 |
| ChEMBL | CHEMBL3183474 |
| ChemSpider | 37765 |