Systematic / IUPAC Name: (4-Ethoxyphenyl)-[3-(4-fluoro-3-phenoxyphenyl)propyl]-dimethylsilane
ID: Reference13517
Other Names: AA-2173
Formula: C25H29FO2Si
Class: Pesticides/Herbicides
Silafluofen mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 385 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 9:04:22 AM |
| InChI | InChI=1S/C25H29FO2Si/c1-4-27-21-13-15-23(16-14-21)29(2,3)18-8-9-20-12-17-24(26)25(19-20)28-22-10-6-5-7-11-22/h5-7,10-17,19H,4,8-9,18H2,1-3H3 |
| InChI Key | HPYNBECUCCGGPA-UHFFFAOYSA-N |
| Canonical SMILES | CCOc1ccc([Si](C)(C)CCCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2173 |
| ChemSpider | 83448 |
| PubChem | 92430 |
| ChEBI | CHEBI:39393 |
| ChEMBL | CHEMBL493481 |
| KEGG | C18412 |
| Wikipedia | Silafluofen |