Systematic / IUPAC Name: Methyl 3,6-dichloro-2-methoxybenzoate
ID: Reference13521
Other Names: AA-2184
Formula: C9H8Cl2O3
Class: Pesticides/Herbicides
Dicamba-methyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1254 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 10:45:47 AM |
| InChI | InChI=1S/C9H8Cl2O3/c1-13-8-6(11)4-3-5(10)7(8)9(12)14-2/h3-4H,1-2H3 |
| InChI Key | AWSBKDYHGOOSML-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)c1c(Cl)ccc(Cl)c1OC |
| CAS | |
| Splash | |
| Other Names | AA-2184 |
| ChEBI | CHEBI:194161 |
| PubChem | 81070 |
| ChemSpider | 73143 |