Systematic / IUPAC Name: [(E)-3-Methylsulfanylbutan-2-ylideneamino] N-methylcarbamate
ID: Reference13522
Other Names: AA-2309
Formula: C7H14N2O2S
Class: Pesticides/Herbicides
Butocarboxim mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 685 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/21/2025 12:55:44 PM |
| InChI | InChI=1S/C7H14N2O2S/c1-5(6(2)12-4)9-11-7(10)8-3/h6H,1-4H3,(H,8,10)/b9-5+ |
| InChI Key | SFNPDDSJBGRXLW-WEVVVXLNSA-N |
| Canonical SMILES | CNC(=O)O/N=C(\C)C(C)SC |
| CAS | |
| Splash | |
| Other Names | AA-2309 |