Systematic / IUPAC Name: 2-Chloro-N-(2,6-dimethylphenyl)-N-[(3-methoxythiophen-2-yl)methyl]acetamide
ID: Reference13523
Other Names: AA-2311
Formula: C16H18ClNO2S
Class: Pesticides/Herbicides
Thenylchlor mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1654 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/22/2025 7:11:03 PM |
| InChI | InChI=1S/C16H18ClNO2S/c1-11-5-4-6-12(2)16(11)18(15(19)9-17)10-14-13(20-3)7-8-21-14/h4-8H,9-10H2,1-3H3 |
| InChI Key | KDWQYMVPYJGPHS-UHFFFAOYSA-N |
| Canonical SMILES | COc1ccsc1CN(C(=O)CCl)c1c(C)cccc1C |
| CAS | |
| Splash | |
| Other Names | AA-2311 |
| KEGG | C10959 |
| ChEBI | CHEBI:9520 |
| PubChem | 443036 |
| ChemSpider | 391337 |