Systematic / IUPAC Name: (2,5-Dichloro-4-iodophenoxy)-dimethoxy-sulfanylidene-λ5-phosphane
ID: Reference13528
Other Names: AA-2316
Formula: C8H8Cl2IO3PS
Class: Pesticides/Herbicides
Iodofenphos mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3349 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/28/2025 12:46:27 PM |
| InChI | InChI=1S/C8H8Cl2IO3PS/c1-12-15(16,13-2)14-8-4-5(9)7(11)3-6(8)10/h3-4H,1-2H3 |
| InChI Key | LFVLUOAHQIVABZ-UHFFFAOYSA-N |
| Canonical SMILES | COP(=S)(OC)Oc1cc(Cl)c(I)cc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2316 |
| ChEBI | CHEBI:82136 |
| KEGG | C19002 |
| ChEMBL | CHEMBL2106359 |
| PubChem | 28935 |
| ChemSpider | 26915 |