Systematic / IUPAC Name: N-Benzyl-2-[4-fluoro-3-(trifluoromethyl)phenoxy]butanamide
ID: Reference13532
Other Names: AA-2027
Formula: C18H17F4NO2
Class: Pesticides/Herbicides
Beflubutamid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3813 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 11:17:44 AM |
| InChI | InChI=1S/C18H17F4NO2/c1-2-16(17(24)23-11-12-6-4-3-5-7-12)25-13-8-9-15(19)14(10-13)18(20,21)22/h3-10,16H,2,11H2,1H3,(H,23,24) |
| InChI Key | FFQPZWRNXKPNPX-UHFFFAOYSA-N |
| Canonical SMILES | CCC(Oc1ccc(F)c(C(F)(F)F)c1)C(=O)NCc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-2027 |
| PubChem | 6451159 |
| ChemSpider | 4953638 |
| ChEBI | CHEBI:138203 |