Systematic / IUPAC Name: Methyl 2-(4-chloro-2-methylphenoxy)propanoate
ID: Reference13534
Other Names: AA-2206
Formula: C11H13ClO3
Class: Pesticides/Herbicides
Mecoprop-methyl mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1276 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 11:22:58 AM |
| InChI | InChI=1S/C11H13ClO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3/h4-6,8H,1-3H3 |
| InChI Key | YWGAULPFWIQKRB-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C(C)Oc1ccc(Cl)cc1C |
| CAS | |
| Splash | |
| Other Names | AA-2206 |