Systematic / IUPAC Name: N,N-Dimethyl-3-oxobutanamide
ID: Reference13537
Other Names: AA-2217
Formula: C6H11NO2
Class: Pesticides/Herbicides
N,N-Dimethylacetoacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 165 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 11:32:51 AM |
| InChI | InChI=1S/C6H11NO2/c1-5(8)4-6(9)7(2)3/h4H2,1-3H3 |
| InChI Key | YPEWWOUWRRQBAX-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)CC(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2217 |
| ChEMBL | CHEMBL3185062 |
| PubChem | 16278 |
| ChemSpider | 15446 |