Systematic / IUPAC Name: Dimethyl (3-methyl-4-methylsulfonylphenyl) phosphate
ID: Reference13545
Other Names:
Fenoxon sulfone;
AA-2337
Formula: C10H15O6PS
Class: Pesticides/Herbicides
Fenthion-oxon-sulfone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1732 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/8/2025 2:04:47 PM |
| InChI | InChI=1S/C10H15O6PS/c1-8-7-9(16-17(11,14-2)15-3)5-6-10(8)18(4,12)13/h5-7H,1-4H3 |
| InChI Key | VUTHWSUXEOILTN-UHFFFAOYSA-N |
| Canonical SMILES | COP(=O)(OC)Oc1ccc(S(C)(=O)=O)c(C)c1 |
| CAS | |
| Splash | |
| Other Names |
Fenoxon sulfone; AA-2337 |