Systematic / IUPAC Name: 4-(7,9-Dioxo-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid
ID: Reference13546
            Other Names: 
                    4-(7,9-Dioxohexahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid; 
                    AA-2339
        
Formula: C18H22N2O5
Class: Pesticides/Herbicides
Pinoxaden M6 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead | 
| No. of Spectral Trees | 2 | 
| No. of Spectra | 7644 | 
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 | 
| Ionization Methods | NSI | 
| Analyzers | FT | 
| Last Modification | 9/8/2025 4:41:55 PM | 
| InChI | InChI=1S/C18H22N2O5/c1-3-11-9-13(18(23)24)10-12(4-2)14(11)15-16(21)19-5-7-25-8-6-20(19)17(15)22/h9-10,15H,3-8H2,1-2H3,(H,23,24) | 
| InChI Key | PZURTZWDEUDQOT-UHFFFAOYSA-N | 
| Canonical SMILES | CCc1cc(C(=O)O)cc(CC)c1C1C(=O)N2CCOCCN2C1=O | 
| CAS | |
| Splash | |
| Other Names | 4-(7,9-Dioxohexahydro-7H-pyrazolo[1,2-d][1,4,5]oxadiazepin-8-yl)-3,5-diethylbenzoic acid; AA-2339 |