Systematic / IUPAC Name:
ID: Reference13548
Other Names: AA-2491
Formula: C4H9NO2
Class: Pesticides/Herbicides
2-Hydroxy-N,N-dimethylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 115 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 8:08:10 AM |
| InChI | InChI=1S/C4H9NO2/c1-5(2)4(7)3-6/h6H,3H2,1-2H3 |
| InChI Key | JNQVLKWNKVMFBN-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=O)CO |
| CAS | |
| Splash | |
| Other Names | AA-2491 |