Systematic / IUPAC Name: 2-Anilino-2-oxoacetic acid
ID: Reference13550
Other Names: AA-2494
Formula: C8H7NO3
Class: Pesticides/Herbicides
Oxanilic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 8:13:03 AM |
| InChI | InChI=1S/C8H7NO3/c10-7(8(11)12)9-6-4-2-1-3-5-6/h1-5H,(H,9,10)(H,11,12) |
| InChI Key | PQJZHMCWDKOPQG-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)C(=O)Nc1ccccc1 |
| CAS | |
| Splash | |
| Other Names | AA-2494 |
| ChemSpider | 9950 |
| PubChem | 10378 |
| ChEMBL | CHEMBL3248231 |