Systematic / IUPAC Name: 5-Chloro-3-fluoro-1H-pyridin-2-one
ID: Reference13551
Other Names: AA-2496
Formula: C5H3ClFNO
Class: Pesticides/Herbicides
5-Chloro-3-fluoro-2-hydroxypyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 700 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 8:42:59 AM |
| InChI | InChI=1S/C5H3ClFNO/c6-3-1-4(7)5(9)8-2-3/h1-2H,(H,8,9) |
| InChI Key | AKLNMOLGRGQMFY-UHFFFAOYSA-N |
| Canonical SMILES | Oc1ncc(Cl)cc1F |
| CAS | |
| Splash | |
| Other Names | AA-2496 |