Systematic / IUPAC Name: (3-Pentan-3-ylphenyl) N-methylcarbamate
ID: Reference13554
            Other Names: 
                    m-(1-Ethylpropyl)phenyl methylcarbamate; 
                    AA-2075
        
Formula: C13H19NO2
Class: Pesticides/Herbicides
3-(3-Pentanyl)phenyl methylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 881 | 
| Tandem Spectra | MS1, MS2, MS3, MS4 | 
| Ionization Methods | NSI | 
| Analyzers | FT | 
| Last Modification | 9/29/2025 9:21:27 AM | 
| InChI | InChI=1S/C13H19NO2/c1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h6-10H,4-5H2,1-3H3,(H,14,15) | 
| InChI Key | SMSFWBAOKCZZBF-UHFFFAOYSA-N | 
| Canonical SMILES | CCC(CC)c1cccc(OC(=O)NC)c1 | 
| CAS | |
| Splash | |
| Other Names | m-(1-Ethylpropyl)phenyl methylcarbamate; AA-2075 |