Systematic / IUPAC Name: 4-Methyl-2-propan-2-yl-1H-pyrimidin-6-one
ID: Reference13556
Other Names: AA-2501
Formula: C8H12N2O
Class: Pesticides/Herbicides
2-Isopropyl-6-methyl-4-pyrimidone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 445 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 11:03:16 AM |
| InChI | InChI=1S/C8H12N2O/c1-5(2)8-9-6(3)4-7(11)10-8/h4-5H,1-3H3,(H,9,10,11) |
| InChI Key | AJPIUNPJBFBUKK-UHFFFAOYSA-N |
| Canonical SMILES | Cc1cc(O)nc(C(C)C)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2501 |
| PubChem | 135444498 |
| ChemSpider | 16799 |
| ChEMBL | CHEMBL3183282 |
| ChEBI | CHEBI:38629 |