Systematic / IUPAC Name: Ethyl 2-[[5-tert-butyl-2-(dimethylcarbamoyl)-1,2,4-triazol-3-yl]sulfanyl]acetate
ID: Reference13559
Other Names: AA-2385
Formula: C13H22N4O3S
Class: Pesticides/Herbicides
Triazamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 345 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 11:49:34 AM |
| InChI | InChI=1S/C13H22N4O3S/c1-7-20-9(18)8-21-11-14-10(13(2,3)4)15-17(11)12(19)16(5)6/h7-8H2,1-6H3 |
| InChI Key | NKNFWVNSBIXGLL-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CSc1nc(C(C)(C)C)nn1C(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | AA-2385 |
| PubChem | 86306 |
| KEGG | C18770 |
| ChEBI | CHEBI:38576 |
| ChemSpider | 77849 |