Systematic / IUPAC Name: 6-Chloro-2-N,2-N,4-N-triethyl-1,3,5-triazine-2,4-diamine
ID: Reference13560
Other Names: AA-2387
Formula: C9H16ClN5
Class: Pesticides/Herbicides
Trietazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 383 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:06:09 PM |
| InChI | InChI=1S/C9H16ClN5/c1-4-11-8-12-7(10)13-9(14-8)15(5-2)6-3/h4-6H2,1-3H3,(H,11,12,13,14) |
| InChI Key | HFBWPRKWDIRYNX-UHFFFAOYSA-N |
| Canonical SMILES | CCNc1nc(Cl)nc(N(CC)CC)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2387 |
| ChEBI | CHEBI:81979 |
| PubChem | 15951 |
| ChemSpider | 15157 |
| KEGG | C18814 |