Systematic / IUPAC Name: N-[(4-Chlorophenyl)methyl]cyclopentanamine
ID: Reference13561
Other Names: AA-2517
Formula: C12H16ClN
Class: Pesticides/Herbicides
N-(4-Chlorobenzyl)cyclopentanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 250 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:08:27 PM |
| InChI | InChI=1S/C12H16ClN/c13-11-7-5-10(6-8-11)9-14-12-3-1-2-4-12/h5-8,12,14H,1-4,9H2 |
| InChI Key | XIXHUNCZQIRQOG-UHFFFAOYSA-N |
| Canonical SMILES | Clc1ccc(CNC2CCCC2)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2517 |
| ChemSpider | 728434 |
| ChEMBL | CHEMBL1619343 |
| PubChem | 834083 |