Systematic / IUPAC Name: 6-Hydroxy-2,2-dioxo-3-propan-2-yl-1H-2λ6,1,3-benzothiadiazin-4-one
ID: Reference13562
Other Names: AA-2519
Formula: C10H12N2O4S
Class: Pesticides/Herbicides
6-Hydroxybentazon mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 375 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:10:18 PM |
| InChI | InChI=1S/C10H12N2O4S/c1-6(2)12-10(14)8-5-7(13)3-4-9(8)11-17(12,15)16/h3-6,11,13H,1-2H3 |
| InChI Key | PVKWIOBXPPFARA-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)N1C(=O)c2cc(O)ccc2NS1(=O)=O |
| CAS | |
| Splash | |
| Other Names | AA-2519 |