Systematic / IUPAC Name: 1-Methyl-3-(trifluoromethyl)pyrazole-4-carboxamide
ID: Reference13564
Other Names: AA-2521
Formula: C6H6F3N3O
Class: Pesticides/Herbicides
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 385 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:13:49 PM |
| InChI | InChI=1S/C6H6F3N3O/c1-12-2-3(5(10)13)4(11-12)6(7,8)9/h2H,1H3,(H2,10,13) |
| InChI Key | UTBJLKDVQNCKAS-UHFFFAOYSA-N |
| Canonical SMILES | Cn1cc(C(N)=O)c(C(F)(F)F)n1 |
| CAS | |
| Splash | |
| Other Names | AA-2521 |