Systematic / IUPAC Name: N-[(6-Chloro-3-pyridinyl)methyl]-N-methylethanimidamide
ID: Reference13565
Other Names: AA-2522
Formula: C9H12ClN3
Class: Pesticides/Herbicides
N-((6-Chloropyridin-3-yl)methyl)-N-methylacetimidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 349 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:16:27 PM |
| InChI | InChI=1S/C9H12ClN3/c1-7(11)13(2)6-8-3-4-9(10)12-5-8/h3-5,11H,6H2,1-2H3 |
| InChI Key | JHZWQGRBAHJYIZ-UHFFFAOYSA-N |
| Canonical SMILES | CC(=N)N(C)Cc1ccc(Cl)nc1 |
| CAS | |
| Splash | |
| Other Names | AA-2522 |