Systematic / IUPAC Name: Propan-2-yl 2,2-bis(4-bromophenyl)-2-hydroxyacetate
ID: Reference13567
Other Names: AA-2351
Formula: C17H16Br2O3
Class: Pesticides/Herbicides
Bromopropylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3092 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/26/2025 9:02:26 AM |
| InChI | InChI=1S/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3 |
| InChI Key | FOANIXZHAMJWOI-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C(O)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2351 |
| PubChem | 28936 |
| ChemSpider | 26916 |
| Wikipedia | Bromopropylate |
| ChEMBL | CHEMBL1867780 |