Systematic / IUPAC Name: [Cyano-(3-phenoxyphenyl)methyl] 2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate
ID: Reference13568
Other Names: AA-2341
Formula: C26H23F2NO4
Class: Pesticides/Herbicides
Flucythrinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1854 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/26/2025 9:04:23 AM |
| InChI | InChI=1S/C26H23F2NO4/c1-17(2)24(18-11-13-21(14-12-18)32-26(27)28)25(30)33-23(16-29)19-7-6-10-22(15-19)31-20-8-4-3-5-9-20/h3-15,17,23-24,26H,1-2H3 |
| InChI Key | GBIHOLCMZGAKNG-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2341 |
| ChEMBL | CHEMBL2289397 |
| PubChem | 50980 |
| Wikipedia | Flucythrinate |
| KEGG | C14524 |
| ChemSpider | 46213 |