Systematic / IUPAC Name: [Methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ6-sulfanylidene]cyanamide
ID: Reference13570
Other Names: AA-2345
Formula: C10H10F3N3OS
Class: Pesticides/Herbicides
Sulfoxaflor mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1889 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/26/2025 9:08:30 AM |
| InChI | InChI=1S/C10H10F3N3OS/c1-7(18(2,17)16-6-14)8-3-4-9(15-5-8)10(11,12)13/h3-5,7H,1-2H3 |
| InChI Key | ZVQOOHYFBIDMTQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(c1ccc(C(F)(F)F)nc1)S(C)(=O)=NC#N |
| CAS | |
| Splash | |
| Other Names | AA-2345 |
| ChEMBL | CHEMBL2230078 |
| Wikipedia | Sulfoxaflor |
| ChEBI | CHEBI:133306 |
| PubChem | 16723172 |
| ChemSpider | 17626728 |