Systematic / IUPAC Name: Ethyl 2,2-bis(4-chlorophenyl)-2-hydroxyacetate
ID: Reference13572
Other Names: AA-2392
Formula: C16H14Cl2O3
Class: Pesticides/Herbicides
Chlorobenzilate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1007 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:24:03 PM |
| InChI | InChI=1S/C16H14Cl2O3/c1-2-21-15(19)16(20,11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12/h3-10,20H,2H2,1H3 |
| InChI Key | RAPBNVDSDCTNRC-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| CAS | |
| Splash | |
| Other Names | AA-2392 |
| ChEBI | CHEBI:34626 |
| KEGG | C14574 |
| ChEMBL | CHEMBL539904 |
| PubChem | 10522 |
| ChemSpider | 10085 |