Systematic / IUPAC Name: 2-(2,4-Dichlorophenyl)acetic acid
ID: Reference13573
Other Names: AA-2393
Formula: C8H6Cl2O2
Class: Pesticides/Herbicides
2,4-Dichlorophenylacetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 90 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:26:24 PM |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) |
| InChI Key | GXMWLJKTGBZMBH-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)Cc1ccc(Cl)cc1Cl |
| CAS | |
| Splash | |
| Other Names | AA-2393 |
| ChemSpider | 79576 |
| PubChem | 88209 |
| ChEMBL | CHEMBL3185822 |