Systematic / IUPAC Name: 1,9,10,11,12,12-Hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide
ID: Reference13574
Other Names: AA-2394
Formula: C9H6Cl6O3S
Class: Pesticides/Herbicides
Endosulfan mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 1 |
| No. of Spectra | 503 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/29/2025 12:29:57 PM |
| InChI | InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2 |
| InChI Key | RDYMFSUJUZBWLH-UHFFFAOYSA-N |
| Canonical SMILES | O=S1OCC2C(CO1)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| CAS | |
| Splash | |
| Other Names | AA-2394 |
| Wikipedia | Endosulfan |
| ChemSpider | 3111 |
| ChEMBL | CHEMBL194399 |
| PubChem | 3224 |
| ChEBI | CHEBI:4791 |