Systematic / IUPAC Name: 1,2,3-Benzothiadiazole-7-carboxylic acid
ID: Reference13576
Other Names:
Acibenzolar acid;
AA-2526
Formula: C7H4N2O2S
Class: Pesticides/Herbicides
Benzothiadiazole-7-carboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 503 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2025 8:32:05 AM |
| InChI | InChI=1S/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11) |
| InChI Key | COAIOOWBEPAOFY-UHFFFAOYSA-N |
| Canonical SMILES | O=C(O)c1cccc2nnsc12 |
| CAS | |
| Splash | |
| Other Names |
Acibenzolar acid; AA-2526 |
| ChEBI | CHEBI:141405 |
| ChemSpider | 9096354 |
| PubChem | 10921109 |
| ChEMBL | CHEMBL2228257 |